C21H23ClN4O3 — CID 91898709
ethyl 5-chloro-6-[4-[(E)-1-phenylethylidenecarbamoyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 91898709) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is ethyl 5-chloro-6-[4-[(E)-1-phenylethylidenecarbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-6-[4-[(E)-1-phenylethylidenecarbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91898709 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl 5-chloro-6-[4-[(E)-1-phenylethylidenecarbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=O)/N=C(\C)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-3-29-20(27)17-13-18(22)19(23-14-17)25-9-11-26(12-10-25)21(28)24-15(2)16-7-5-4-6-8-16/h4-8,13-14H,3,9-12H2,1-2H3/b24-15+ |
| InChIKey | SXKPXVPTECDAJM-BUVRLJJBSA-N |
| XLogP | 3.66 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|