C20H21F3N3O2+ — CID 9209608
N-(3-acetylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide (PubChem CID 9209608) has the molecular formula C20H21F3N3O2+ and a molecular weight of 392.40 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9209608 |
| Molecular Formula | C20H21F3N3O2+ |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(3-acetylphenyl)-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)c1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-13(27)15-3-2-4-17(11-15)25-19(28)14-7-9-26(10-8-14)18-6-5-16(12-24-18)20(21,22)23/h2-6,11-12,14H,7-10H2,1H3,(H,25,28)/p+1 |
| InChIKey | OTULZQATMYYHLQ-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |