C18H27F3N5OS+ — CID 9187699
1-pentyl-3-[[1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carbonyl]amino]thiourea (PubChem CID 9187699) has the molecular formula C18H27F3N5OS+ and a molecular weight of 418.51 g/mol. Its IUPAC name is 1-pentyl-3-[[1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carbonyl]amino]thiourea.
| Compound Name | 1-pentyl-3-[[1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 9187699 |
| Molecular Formula | C18H27F3N5OS+ |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-pentyl-3-[[1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carbonyl]amino]thiourea |
| SMILES | CCCCCNC(=S)NNC(=O)C1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1 |
| InChI | InChI=1S/C18H26F3N5OS/c1-2-3-4-9-22-17(28)25-24-16(27)13-7-10-26(11-8-13)15-6-5-14(12-23-15)18(19,20)21/h5-6,12-13H,2-4,7-11H2,1H3,(H,24,27)(H2,22,25,28)/p+1 |
| InChIKey | NKDDYFFJCCBZPF-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 70.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|