C24H30F3N4O+ — CID 163684755
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide (PubChem CID 163684755) has the molecular formula C24H30F3N4O+ and a molecular weight of 447.53 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163684755 |
| Molecular Formula | C24H30F3N4O+ |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)C1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1 |
| InChI | InChI=1S/C24H29F3N4O/c25-24(26,27)21-6-7-22(29-16-21)31-14-9-19(10-15-31)23(32)28-11-3-12-30-13-8-18-4-1-2-5-20(18)17-30/h1-2,4-7,16,19H,3,8-15,17H2,(H,28,32)/p+1 |
| InChIKey | JNWYGQZIOQHXDB-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 49.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|