C24H31N3O3S — CID 133167879
1-(benzenesulfonyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-3-carboxamide (PubChem CID 133167879) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133167879 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C24H31N3O3S/c28-24(25-14-7-15-26-17-13-20-8-4-5-9-21(20)18-26)22-10-6-16-27(19-22)31(29,30)23-11-2-1-3-12-23/h1-5,8-9,11-12,22H,6-7,10,13-19H2,(H,25,28) |
| InChIKey | PCJCJTGUULEXLT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|