C23H28FN3O3S — CID 133168284
N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133168284) has the molecular formula C23H28FN3O3S and a molecular weight of 445.56 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133168284 |
| Molecular Formula | C23H28FN3O3S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc21)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H28FN3O3S/c24-20-8-10-21(11-9-20)31(29,30)27-15-3-6-19(17-27)23(28)25-13-4-14-26-16-12-18-5-1-2-7-22(18)26/h1-2,5,7-11,19H,3-4,6,12-17H2,(H,25,28) |
| InChIKey | JXORTLPIRSRJCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|