C17H25N3O — CID 81133525
(3R)-N-[3-(2,3-dihydroindol-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 81133525) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (3R)-N-[3-(2,3-dihydroindol-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(2,3-dihydroindol-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81133525 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (3R)-N-[3-(2,3-dihydroindol-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc21)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C17H25N3O/c21-17(15-6-3-9-18-13-15)19-10-4-11-20-12-8-14-5-1-2-7-16(14)20/h1-2,5,7,15,18H,3-4,6,8-13H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | PEIUPJNHSHKGHQ-OAHLLOKOSA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|