C20H31N3O — CID 119851195
N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide (PubChem CID 119851195) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119851195 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCCCN1CCc2ccccc21)C1CCCNC1 |
| InChI | InChI=1S/C20H31N3O/c1-16(18-7-4-10-21-15-18)14-20(24)22-11-5-12-23-13-9-17-6-2-3-8-19(17)23/h2-3,6,8,16,18,21H,4-5,7,9-15H2,1H3,(H,22,24) |
| InChIKey | OPOJZTIZGZQCTI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|