C20H33Cl2N3O — CID 119851194
N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119851194) has the molecular formula C20H33Cl2N3O and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119851194 |
| Molecular Formula | C20H33Cl2N3O |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCCCN1CCc2ccccc21)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C20H31N3O.2ClH/c1-16(18-7-4-10-21-15-18)14-20(24)22-11-5-12-23-13-9-17-6-2-3-8-19(17)23;;/h2-3,6,8,16,18,21H,4-5,7,9-15H2,1H3,(H,22,24);2*1H |
| InChIKey | CQJSOPFTVCXEIO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|