C20H29N3O3 — CID 119800553
N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-piperidin-3-ylbutanamide (PubChem CID 119800553) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119800553 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCCCN1C(=O)COc2ccccc21)C1CCCNC1 |
| InChI | InChI=1S/C20H29N3O3/c1-15(16-6-4-9-21-13-16)12-19(24)22-10-5-11-23-17-7-2-3-8-18(17)26-14-20(23)25/h2-3,7-8,15-16,21H,4-6,9-14H2,1H3,(H,22,24) |
| InChIKey | FJYWDTBQASMFKY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|