C17H23N3O3 — CID 119333214
N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidine-2-carboxamide (PubChem CID 119333214) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidine-2-carboxamide.
| Compound Name | N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119333214 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidine-2-carboxamide |
| SMILES | O=C(NCCCN1C(=O)COc2ccccc21)C1CCCCN1 |
| InChI | InChI=1S/C17H23N3O3/c21-16-12-23-15-8-2-1-7-14(15)20(16)11-5-10-19-17(22)13-6-3-4-9-18-13/h1-2,7-8,13,18H,3-6,9-12H2,(H,19,22) |
| InChIKey | HKQCTLLNCROSCW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|