C18H23N3O4 — CID 4200810
N-(2-oxoazepan-3-yl)-4-(3-oxo-1,4-benzoxazin-4-yl)butanamide (PubChem CID 4200810) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-4-(3-oxo-1,4-benzoxazin-4-yl)butanamide.
| Compound Name | N-(2-oxoazepan-3-yl)-4-(3-oxo-1,4-benzoxazin-4-yl)butanamide |
|---|---|
| PubChem CID | 4200810 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-4-(3-oxo-1,4-benzoxazin-4-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)COc2ccccc21)NC1CCCCNC1=O |
| InChI | InChI=1S/C18H23N3O4/c22-16(20-13-6-3-4-10-19-18(13)24)9-5-11-21-14-7-1-2-8-15(14)25-12-17(21)23/h1-2,7-8,13H,3-6,9-12H2,(H,19,24)(H,20,22) |
| InChIKey | RMVDVRBPIJFYGM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |