C12H12NO4- — CID 7442942
4-(3-oxo-1,4-benzoxazin-4-yl)butanoate (PubChem CID 7442942) has the molecular formula C12H12NO4- and a molecular weight of 234.23 g/mol. Its IUPAC name is 4-(3-oxo-1,4-benzoxazin-4-yl)butanoate.
| Compound Name | 4-(3-oxo-1,4-benzoxazin-4-yl)butanoate |
|---|---|
| PubChem CID | 7442942 |
| Molecular Formula | C12H12NO4- |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(3-oxo-1,4-benzoxazin-4-yl)butanoate |
| SMILES | O=C([O-])CCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C12H13NO4/c14-11-8-17-10-5-2-1-4-9(10)13(11)7-3-6-12(15)16/h1-2,4-5H,3,6-8H2,(H,15,16)/p-1 |
| InChIKey | VCUKRAAGUIPUJF-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |