C13H18N2O2 — CID 117007291
4-[3-(dimethylamino)propyl]-1,4-benzoxazin-3-one (PubChem CID 117007291) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-(dimethylamino)propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 117007291 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-[3-(dimethylamino)propyl]-1,4-benzoxazin-3-one |
| SMILES | CN(C)CCCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C13H18N2O2/c1-14(2)8-5-9-15-11-6-3-4-7-12(11)17-10-13(15)16/h3-4,6-7H,5,8-10H2,1-2H3 |
| InChIKey | VEYWTJVJKYXPMC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |