C13H21NO2 — CID 91027337
ethane;4-methyl-1,4-benzoxazin-3-one (PubChem CID 91027337) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;4-methyl-1,4-benzoxazin-3-one.
| Compound Name | ethane;4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 91027337 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;4-methyl-1,4-benzoxazin-3-one |
| SMILES | CC.CC.CN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C9H9NO2.2C2H6/c1-10-7-4-2-3-5-8(7)12-6-9(10)11;2*1-2/h2-5H,6H2,1H3;2*1-2H3 |
| InChIKey | TXRCRTOHWZTSRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |