C9H9NO4 — CID 118920596
6-hydroperoxy-4-methyl-1,4-benzoxazin-3-one (PubChem CID 118920596) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is 6-hydroperoxy-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-hydroperoxy-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118920596 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 6-hydroperoxy-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(OO)cc21 |
| InChI | InChI=1S/C9H9NO4/c1-10-7-4-6(14-12)2-3-8(7)13-5-9(10)11/h2-4,12H,5H2,1H3 |
| InChIKey | CGQBFSPBCKYREL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|