C13H16N2O4 — CID 82316757
methyl 3-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)amino]propanoate (PubChem CID 82316757) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 3-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)amino]propanoate.
| Compound Name | methyl 3-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)amino]propanoate |
|---|---|
| PubChem CID | 82316757 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 3-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C13H16N2O4/c1-15-10-7-9(14-6-5-13(17)18-2)3-4-11(10)19-8-12(15)16/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | KPXZDIIWKNTQLA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|