C17H24N4O4S — CID 84554050
tert-butyl N-[2-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)carbamothioylamino]ethyl]carbamate (PubChem CID 84554050) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84554050 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | tert-butyl N-[2-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)carbamothioylamino]ethyl]carbamate |
| SMILES | CN1C(=O)COc2ccc(NC(=S)NCCNC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C17H24N4O4S/c1-17(2,3)25-16(23)19-8-7-18-15(26)20-11-5-6-13-12(9-11)21(4)14(22)10-24-13/h5-6,9H,7-8,10H2,1-4H3,(H,19,23)(H2,18,20,26) |
| InChIKey | VZDWJTGRPHPJAA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|