C13H18N4O5S — CID 125130737
1-[2-(methanesulfonamido)ethyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)urea (PubChem CID 125130737) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)urea.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)urea |
|---|---|
| PubChem CID | 125130737 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)urea |
| SMILES | CN1C(=O)COc2ccc(NC(=O)NCCNS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C13H18N4O5S/c1-17-10-7-9(3-4-11(10)22-8-12(17)18)16-13(19)14-5-6-15-23(2,20)21/h3-4,7,15H,5-6,8H2,1-2H3,(H2,14,16,19) |
| InChIKey | XODLHIUVCYUGGC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|