C13H18N2O3 — CID 82499150
7-(2-methoxyethylamino)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 82499150) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 7-(2-methoxyethylamino)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 7-(2-methoxyethylamino)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82499150 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 7-(2-methoxyethylamino)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | COCCNc1ccc2c(c1)N(C)C(=O)CCO2 |
| InChI | InChI=1S/C13H18N2O3/c1-15-11-9-10(14-6-8-17-2)3-4-12(11)18-7-5-13(15)16/h3-4,9,14H,5-8H2,1-2H3 |
| InChIKey | MWGPONQKWAUBBR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|