C12H18N4O2 — CID 115119417
6-(2,3-diaminopropylamino)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 115119417) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(2,3-diaminopropylamino)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,3-diaminopropylamino)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115119417 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-(2,3-diaminopropylamino)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(NCC(N)CN)cc21 |
| InChI | InChI=1S/C12H18N4O2/c1-16-10-4-9(15-6-8(14)5-13)2-3-11(10)18-7-12(16)17/h2-4,8,15H,5-7,13-14H2,1H3 |
| InChIKey | XTNJZHVGYAJZAN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|