C16H15NO3 — CID 117001096
6-(4-methoxyphenyl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 117001096) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-methoxyphenyl)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 117001096 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-(4-methoxyphenyl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(-c2ccc3c(c2)N(C)C(=O)CO3)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-17-14-9-12(5-8-15(14)20-10-16(17)18)11-3-6-13(19-2)7-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | YSYBJLRCMNQVJM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |