C21H21N4O4+ — CID 142893432
(3,5-dimethoxyphenyl)-[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]azanium (PubChem CID 142893432) has the molecular formula C21H21N4O4+ and a molecular weight of 393.42 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]azanium.
| Compound Name | (3,5-dimethoxyphenyl)-[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 142893432 |
| Molecular Formula | C21H21N4O4+ |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]azanium |
| SMILES | COc1cc([NH2+]c2nccc(-c3ccc4c(c3)N(C)C(=O)CO4)n2)cc(OC)c1 |
| InChI | InChI=1S/C21H20N4O4/c1-25-18-8-13(4-5-19(18)29-12-20(25)26)17-6-7-22-21(24-17)23-14-9-15(27-2)11-16(10-14)28-3/h4-11H,12H2,1-3H3,(H,22,23,24)/p+1 |
| InChIKey | PKIBKRGXPXPEBQ-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|