About 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride
3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371328) has the molecular formula C13H9ClN2O4
and a molecular weight of 292.68 g/mol. Its IUPAC name is 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride.
Molecular Properties
| Compound Name | 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride |
| PubChem CID | 82371328 |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride |
| SMILES | CN1C(=O)COc2ccc(-c3cc(C(=O)Cl)on3)cc21 |
| InChI | InChI=1S/C13H9ClN2O4/c1-16-9-4-7(2-3-10(9)19-6-12(16)17)8-5-11(13(14)18)20-15-8/h2-5H,6H2,1H3 |
| InChIKey | BYVFMHXUPKSJGZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride?
The IUPAC name of 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride (CID 82371328) is 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride.
What is the SMILES notation for 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride?
The canonical SMILES for 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride is CN1C(=O)COc2ccc(-c3cc(C(=O)Cl)on3)cc21.
What is the InChIKey of 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride?
The InChIKey is BYVFMHXUPKSJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2O4/c1-16-9-4-7(2-3-10(9)19-6-12(16)17)8-5-11(13(14)18)20-15-8/h2-5H,6H2,1H3.
What are the key properties of 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride?
3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride has a molecular weight of 292.68 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride is sourced from PubChem (CID 82371328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).