C12H7ClN2O4 — CID 82371348
3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride (PubChem CID 82371348) has the molecular formula C12H7ClN2O4 and a molecular weight of 278.65 g/mol. Its IUPAC name is 3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride.
| Compound Name | 3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 82371348 |
| Molecular Formula | C12H7ClN2O4 |
| Molecular Weight | 278.65 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,2-oxazole-5-carbonyl chloride |
| SMILES | O=C1COc2ccc(-c3cc(C(=O)Cl)on3)cc2N1 |
| InChI | InChI=1S/C12H7ClN2O4/c13-12(17)10-4-7(15-19-10)6-1-2-9-8(3-6)14-11(16)5-18-9/h1-4H,5H2,(H,14,16) |
| InChIKey | LPWUHQVGFPDUGD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|