C13H13N3O3 — CID 82483845
6-[3-(2-aminoethyl)-1,2-oxazol-5-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 82483845) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 6-[3-(2-aminoethyl)-1,2-oxazol-5-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(2-aminoethyl)-1,2-oxazol-5-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82483845 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-[3-(2-aminoethyl)-1,2-oxazol-5-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | NCCc1cc(-c2ccc3c(c2)NC(=O)CO3)on1 |
| InChI | InChI=1S/C13H13N3O3/c14-4-3-9-6-12(19-16-9)8-1-2-11-10(5-8)15-13(17)7-18-11/h1-2,5-6H,3-4,7,14H2,(H,15,17) |
| InChIKey | NTMIUBCKLJNPGY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |