C16H17N3O3 — CID 177226925
6-(3-piperidin-4-yl-1,2-oxazol-5-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 177226925) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-(3-piperidin-4-yl-1,2-oxazol-5-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-piperidin-4-yl-1,2-oxazol-5-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 177226925 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(3-piperidin-4-yl-1,2-oxazol-5-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cc(C4CCNCC4)no3)cc2N1 |
| InChI | InChI=1S/C16H17N3O3/c20-16-9-21-14-2-1-11(7-13(14)18-16)15-8-12(19-22-15)10-3-5-17-6-4-10/h1-2,7-8,10,17H,3-6,9H2,(H,18,20) |
| InChIKey | GVRNOBYFCHLNOD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |