C11H7ClN2O2S — CID 116968112
6-(2-chloro-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 116968112) has the molecular formula C11H7ClN2O2S and a molecular weight of 266.71 g/mol. Its IUPAC name is 6-(2-chloro-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloro-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116968112 |
| Molecular Formula | C11H7ClN2O2S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 6-(2-chloro-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3csc(Cl)n3)cc2N1 |
| InChI | InChI=1S/C11H7ClN2O2S/c12-11-14-8(5-17-11)6-1-2-9-7(3-6)13-10(15)4-16-9/h1-3,5H,4H2,(H,13,15) |
| InChIKey | GVJCTLHHBGNDFS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |