C15H10N2O2S2 — CID 7529130
6-(2-thiophen-2-yl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 7529130) has the molecular formula C15H10N2O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-(2-thiophen-2-yl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-thiophen-2-yl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7529130 |
| Molecular Formula | C15H10N2O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 6-(2-thiophen-2-yl-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3csc(-c4cccs4)n3)cc2N1 |
| InChI | InChI=1S/C15H10N2O2S2/c18-14-7-19-12-4-3-9(6-10(12)16-14)11-8-21-15(17-11)13-2-1-5-20-13/h1-6,8H,7H2,(H,16,18) |
| InChIKey | NHBNNOYCAZHUEG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |