C11H10ClFN2O — CID 82477361
2-[5-(3-chloro-4-fluorophenyl)-1,2-oxazol-3-yl]ethanamine (PubChem CID 82477361) has the molecular formula C11H10ClFN2O and a molecular weight of 240.67 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-fluorophenyl)-1,2-oxazol-3-yl]ethanamine.
| Compound Name | 2-[5-(3-chloro-4-fluorophenyl)-1,2-oxazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 82477361 |
| Molecular Formula | C11H10ClFN2O |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[5-(3-chloro-4-fluorophenyl)-1,2-oxazol-3-yl]ethanamine |
| SMILES | NCCc1cc(-c2ccc(F)c(Cl)c2)on1 |
| InChI | InChI=1S/C11H10ClFN2O/c12-9-5-7(1-2-10(9)13)11-6-8(3-4-14)15-16-11/h1-2,5-6H,3-4,14H2 |
| InChIKey | VKSVOEJEGLWHPO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |