C14H17ClFN3O — CID 63093946
6-[3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine (PubChem CID 63093946) has the molecular formula C14H17ClFN3O and a molecular weight of 297.76 g/mol. Its IUPAC name is 6-[3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine.
| Compound Name | 6-[3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 63093946 |
| Molecular Formula | C14H17ClFN3O |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 6-[3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
| SMILES | NCCCCCCc1nc(-c2ccc(F)c(Cl)c2)no1 |
| InChI | InChI=1S/C14H17ClFN3O/c15-11-9-10(6-7-12(11)16)14-18-13(20-19-14)5-3-1-2-4-8-17/h6-7,9H,1-5,8,17H2 |
| InChIKey | FTKQFTVSKZCVGJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|