C15H20BrN3O — CID 104880999
6-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine (PubChem CID 104880999) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 6-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine.
| Compound Name | 6-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 104880999 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 6-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]hexan-1-amine |
| SMILES | Cc1ccc(-c2noc(CCCCCCN)n2)cc1Br |
| InChI | InChI=1S/C15H20BrN3O/c1-11-7-8-12(10-13(11)16)15-18-14(20-19-15)6-4-2-3-5-9-17/h7-8,10H,2-6,9,17H2,1H3 |
| InChIKey | VDLCUIFQGSTEES-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|