C17H19N3O — CID 62717251
5-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 62717251) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 5-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 62717251 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C17H19N3O/c18-11-5-1-2-8-16-19-17(20-21-16)15-10-9-13-6-3-4-7-14(13)12-15/h3-4,6-7,9-10,12H,1-2,5,8,11,18H2 |
| InChIKey | GWNCDEAWQMYXGY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|