C11H15N5O — CID 43622167
5-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 43622167) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 5-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 43622167 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 5-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2ncccn2)no1 |
| InChI | InChI=1S/C11H15N5O/c12-6-3-1-2-5-9-15-11(16-17-9)10-13-7-4-8-14-10/h4,7-8H,1-3,5-6,12H2 |
| InChIKey | VWVQFFPKEKBWDF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|