methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate

C16H14N2O3 — CID 44543077

IUPACmethyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate
SMILESCOC(=O)CCc1nc(-c2ccc3ccccc3c2)no1
InChIInChI=1S/C16H14N2O3/c1-20-15(19)9-8-14-17-16(18-21-14)13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10H,8-9H2,1H3
InChIKeyVONYVUPJXSBDMX-UHFFFAOYSA-N
MW282.30 g/mol
LogP3.00
Rot. Bonds4

About methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate

methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 44543077) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate
PubChem CID44543077
Molecular FormulaC16H14N2O3
Molecular Weight282.30 g/mol
Exact Mass282.10
IUPAC Namemethyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate
SMILESCOC(=O)CCc1nc(-c2ccc3ccccc3c2)no1
InChIInChI=1S/C16H14N2O3/c1-20-15(19)9-8-14-17-16(18-21-14)13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10H,8-9H2,1H3
InChIKeyVONYVUPJXSBDMX-UHFFFAOYSA-N
XLogP3.00
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 53.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate?
The IUPAC name of methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate (CID 44543077) is methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate.
What is the SMILES notation for methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate?
The canonical SMILES for methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate is COC(=O)CCc1nc(-c2ccc3ccccc3c2)no1.
What is the InChIKey of methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate?
The InChIKey is VONYVUPJXSBDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-20-15(19)9-8-14-17-16(18-21-14)13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10H,8-9H2,1H3.
What are the key properties of methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate?
methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate has a molecular weight of 282.30 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate is sourced from PubChem (CID 44543077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).