C16H14N2O3 — CID 44543077
methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 44543077) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 44543077 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 3-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | COC(=O)CCc1nc(-c2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C16H14N2O3/c1-20-15(19)9-8-14-17-16(18-21-14)13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10H,8-9H2,1H3 |
| InChIKey | VONYVUPJXSBDMX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |