C18H15FN2O4 — CID 24592484
(4-fluorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 24592484) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is (4-fluorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | (4-fluorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 24592484 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (4-fluorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | COc1ccc(-c2noc(CCC(=O)Oc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H15FN2O4/c1-23-14-6-2-12(3-7-14)18-20-16(25-21-18)10-11-17(22)24-15-8-4-13(19)5-9-15/h2-9H,10-11H2,1H3 |
| InChIKey | AWTFDQILSREOJM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|