C18H14BrClN2O4 — CID 24594435
(2-bromo-4-chlorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 24594435) has the molecular formula C18H14BrClN2O4 and a molecular weight of 437.68 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | (2-bromo-4-chlorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 24594435 |
| Molecular Formula | C18H14BrClN2O4 |
| Molecular Weight | 437.68 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | COc1ccc(-c2noc(CCC(=O)Oc3ccc(Cl)cc3Br)n2)cc1 |
| InChI | InChI=1S/C18H14BrClN2O4/c1-24-13-5-2-11(3-6-13)18-21-16(26-22-18)8-9-17(23)25-15-7-4-12(20)10-14(15)19/h2-7,10H,8-9H2,1H3 |
| InChIKey | XJOLGZVVOYXPDU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|