C22H22N2O5S2 — CID 16600759
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 16600759) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 16600759 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | COc1ccc(-c2noc(CCC(=O)Oc3ccc(C4SCCS4)cc3OC)n2)cc1 |
| InChI | InChI=1S/C22H22N2O5S2/c1-26-16-6-3-14(4-7-16)21-23-19(29-24-21)9-10-20(25)28-17-8-5-15(13-18(17)27-2)22-30-11-12-31-22/h3-8,13,22H,9-12H2,1-2H3 |
| InChIKey | TUPCGWODCLCJBP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|