C26H21N3O4 — CID 55577146
[4-(4-cyanophenyl)phenyl] 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 55577146) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 55577146 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C26H21N3O4/c1-2-31-22-11-9-21(10-12-22)26-28-24(33-29-26)15-16-25(30)32-23-13-7-20(8-14-23)19-5-3-18(17-27)4-6-19/h3-14H,2,15-16H2,1H3 |
| InChIKey | SPZCVYPFAGCYOF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 98.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|