C25H20FN3O4 — CID 55684802
(4-benzamidophenyl) 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 55684802) has the molecular formula C25H20FN3O4 and a molecular weight of 445.45 g/mol. Its IUPAC name is (4-benzamidophenyl) 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | (4-benzamidophenyl) 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 55684802 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (4-benzamidophenyl) 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | O=C(CCCc1nc(-c2ccc(F)cc2)no1)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20FN3O4/c26-19-11-9-17(10-12-19)24-28-22(33-29-24)7-4-8-23(30)32-21-15-13-20(14-16-21)27-25(31)18-5-2-1-3-6-18/h1-3,5-6,9-16H,4,7-8H2,(H,27,31) |
| InChIKey | YZAAWRHDCATGNI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|