C22H16FN3O2 — CID 17052840
N-[4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]-4-fluorobenzamide (PubChem CID 17052840) has the molecular formula C22H16FN3O2 and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 17052840 |
| Molecular Formula | C22H16FN3O2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2noc(Cc3ccccc3)n2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN3O2/c23-18-10-6-17(7-11-18)22(27)24-19-12-8-16(9-13-19)21-25-20(28-26-21)14-15-4-2-1-3-5-15/h1-13H,14H2,(H,24,27) |
| InChIKey | QCSWCPVPUWNEOL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |