C17H20FN3O4 — CID 39704791
methyl 4-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]butanoate (PubChem CID 39704791) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is methyl 4-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]butanoate.
| Compound Name | methyl 4-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]butanoate |
|---|---|
| PubChem CID | 39704791 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | methyl 4-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H20FN3O4/c1-24-16(23)6-3-11-19-14(22)4-2-5-15-20-17(21-25-15)12-7-9-13(18)10-8-12/h7-10H,2-6,11H2,1H3,(H,19,22) |
| InChIKey | HRMHJAJMHKANON-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|