C19H19FN4O4 — CID 55688084
N-[2-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]furan-2-carboxamide (PubChem CID 55688084) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is N-[2-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55688084 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[2-[4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]butanoylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(CCCc1nc(-c2ccc(F)cc2)no1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C19H19FN4O4/c20-14-8-6-13(7-9-14)18-23-17(28-24-18)5-1-4-16(25)21-10-11-22-19(26)15-3-2-12-27-15/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,25)(H,22,26) |
| InChIKey | YWAHUZGQOMWJGR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|