C17H22FN3O2 — CID 38885235
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentylbutanamide (PubChem CID 38885235) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentylbutanamide.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentylbutanamide |
|---|---|
| PubChem CID | 38885235 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)CCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H22FN3O2/c1-2-3-4-12-19-15(22)6-5-7-16-20-17(21-23-16)13-8-10-14(18)11-9-13/h8-11H,2-7,12H2,1H3,(H,19,22) |
| InChIKey | DFRICRSSRIHIJI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|