C22H17N3O4S — CID 35625078
[4-(thiophene-2-carbonylamino)phenyl] 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 35625078) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 35625078 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | O=C(CCc1nc(-c2ccccc2)no1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H17N3O4S/c26-20(13-12-19-24-21(25-29-19)15-5-2-1-3-6-15)28-17-10-8-16(9-11-17)23-22(27)18-7-4-14-30-18/h1-11,14H,12-13H2,(H,23,27) |
| InChIKey | FOJULQMGCWGZJZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|