C20H16FNO3S — CID 35624176
[4-(thiophene-2-carbonylamino)phenyl] 3-(4-fluorophenyl)propanoate (PubChem CID 35624176) has the molecular formula C20H16FNO3S and a molecular weight of 369.42 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 35624176 |
| Molecular Formula | C20H16FNO3S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 3-(4-fluorophenyl)propanoate |
| SMILES | O=C(CCc1ccc(F)cc1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H16FNO3S/c21-15-6-3-14(4-7-15)5-12-19(23)25-17-10-8-16(9-11-17)22-20(24)18-2-1-13-26-18/h1-4,6-11,13H,5,12H2,(H,22,24) |
| InChIKey | HJGQMFIPHPUGPK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|