C20H16FNO4S — CID 36666713
[4-(thiophene-2-carbonylamino)phenyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 36666713) has the molecular formula C20H16FNO4S and a molecular weight of 385.42 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 36666713 |
| Molecular Formula | C20H16FNO4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc(NC(=O)c3cccs3)cc2)cc1F |
| InChI | InChI=1S/C20H16FNO4S/c1-25-17-9-4-13(11-16(17)21)12-19(23)26-15-7-5-14(6-8-15)22-20(24)18-3-2-10-27-18/h2-11H,12H2,1H3,(H,22,24) |
| InChIKey | ZMFICAZUYJVOTR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|