About [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate
[4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate (PubChem CID 102603587) has the molecular formula C20H17NO4S
and a molecular weight of 367.43 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate.
Molecular Properties
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate |
| PubChem CID | 102603587 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate |
| SMILES | O=C(COCc1ccccc1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H17NO4S/c22-19(14-24-13-15-5-2-1-3-6-15)25-17-10-8-16(9-11-17)21-20(23)18-7-4-12-26-18/h1-12H,13-14H2,(H,21,23) |
| InChIKey | CBFLCWANCGVCSI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate?
The IUPAC name of [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate (CID 102603587) is [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate.
What is the SMILES notation for [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate?
The canonical SMILES for [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate is O=C(COCc1ccccc1)Oc1ccc(NC(=O)c2cccs2)cc1.
What is the InChIKey of [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate?
The InChIKey is CBFLCWANCGVCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4S/c22-19(14-24-13-15-5-2-1-3-6-15)25-17-10-8-16(9-11-17)21-20(23)18-7-4-12-26-18/h1-12H,13-14H2,(H,21,23).
What are the key properties of [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate?
[4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate has a molecular weight of 367.43 g/mol, XLogP of 4.12, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(thiophene-2-carbonylamino)phenyl] 2-phenylmethoxyacetate is sourced from PubChem (CID 102603587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).