C19H16N2O2S — CID 2979144
N-[4-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 2979144) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[4-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2979144 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[4-(benzylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H16N2O2S/c22-18(20-13-14-5-2-1-3-6-14)15-8-10-16(11-9-15)21-19(23)17-7-4-12-24-17/h1-12H,13H2,(H,20,22)(H,21,23) |
| InChIKey | ZSJFHJZKDGEZNB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |