C17H13N3O3S2 — CID 1117998
N-[4-[(thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 1117998) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-[(thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1117998 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[4-[(thiophene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H13N3O3S2/c21-15(19-20-17(23)14-4-2-10-25-14)11-5-7-12(8-6-11)18-16(22)13-3-1-9-24-13/h1-10H,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | UGUUYAGRVUVRMJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|